C26H29NO4 — CID 23773222
1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23773222) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23773222 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-methylphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)CC(c3ccc(C)cc3)C3=C2CC(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C26H29NO4/c1-16-6-8-17(9-7-16)21-13-24(29)27(18-10-19(30-4)12-20(11-18)31-5)22-14-26(2,3)15-23(28)25(21)22/h6-12,21H,13-15H2,1-5H3 |
| InChIKey | STJWFYNPFXBXOQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |