C32H35NO7S — CID 126074317
2-[3,3,6,6-tetramethyl-9-[3-(4-methylphenyl)sulfonyloxyphenyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126074317) has the molecular formula C32H35NO7S and a molecular weight of 577.70 g/mol. Its IUPAC name is 2-[3,3,6,6-tetramethyl-9-[3-(4-methylphenyl)sulfonyloxyphenyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[3,3,6,6-tetramethyl-9-[3-(4-methylphenyl)sulfonyloxyphenyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126074317 |
| Molecular Formula | C32H35NO7S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 2-[3,3,6,6-tetramethyl-9-[3-(4-methylphenyl)sulfonyloxyphenyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(C3C4=C(CC(C)(C)CC4=O)N(CC(=O)O)C4=C3C(=O)CC(C)(C)C4)c2)cc1 |
| InChI | InChI=1S/C32H35NO7S/c1-19-9-11-22(12-10-19)41(38,39)40-21-8-6-7-20(13-21)28-29-23(14-31(2,3)16-25(29)34)33(18-27(36)37)24-15-32(4,5)17-26(35)30(24)28/h6-13,28H,14-18H2,1-5H3,(H,36,37) |
| InChIKey | QWISBLAVILSTAE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|