C21H21NO5 — CID 102146169
2-(6,6-dimethyl-1,8-dioxo-9-phenyl-3,5,7,9-tetrahydrofuro[3,4-b]quinolin-4-yl)acetic acid (PubChem CID 102146169) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(6,6-dimethyl-1,8-dioxo-9-phenyl-3,5,7,9-tetrahydrofuro[3,4-b]quinolin-4-yl)acetic acid.
| Compound Name | 2-(6,6-dimethyl-1,8-dioxo-9-phenyl-3,5,7,9-tetrahydrofuro[3,4-b]quinolin-4-yl)acetic acid |
|---|---|
| PubChem CID | 102146169 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(6,6-dimethyl-1,8-dioxo-9-phenyl-3,5,7,9-tetrahydrofuro[3,4-b]quinolin-4-yl)acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CC(=O)O)C1=C(C(=O)OC1)C2c1ccccc1 |
| InChI | InChI=1S/C21H21NO5/c1-21(2)8-13-18(15(23)9-21)17(12-6-4-3-5-7-12)19-14(11-27-20(19)26)22(13)10-16(24)25/h3-7,17H,8-11H2,1-2H3,(H,24,25) |
| InChIKey | OJKXGVLURSBKMF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |