C20H20BrNO3 — CID 126043079
9-(5-bromo-2-hydroxyphenyl)-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126043079) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is 9-(5-bromo-2-hydroxyphenyl)-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(5-bromo-2-hydroxyphenyl)-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126043079 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 9-(5-bromo-2-hydroxyphenyl)-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2cc(Br)ccc2O)C2=C1CCCC2=O |
| InChI | InChI=1S/C20H20BrNO3/c1-22-13-4-2-6-16(24)19(13)18(12-10-11(21)8-9-15(12)23)20-14(22)5-3-7-17(20)25/h8-10,18,23H,2-7H2,1H3 |
| InChIKey | SARNEGBCRSJGQO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |