C31H27Br2NO3 — CID 126048864
9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126048864) has the molecular formula C31H27Br2NO3 and a molecular weight of 621.37 g/mol. Its IUPAC name is 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126048864 |
| Molecular Formula | C31H27Br2NO3 |
| Molecular Weight | 621.37 g/mol |
| Exact Mass | 619.04 |
| IUPAC Name | 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2cc(Br)cc(Br)c2OCc2cccc3ccccc23)C2=C1CCCC2=O |
| InChI | InChI=1S/C31H27Br2NO3/c1-34-24-11-5-13-26(35)29(24)28(30-25(34)12-6-14-27(30)36)22-15-20(32)16-23(33)31(22)37-17-19-9-4-8-18-7-2-3-10-21(18)19/h2-4,7-10,15-16,28H,5-6,11-14,17H2,1H3 |
| InChIKey | MYKBNBABGDDNNP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.37 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |