C34H33Br2NO3 — CID 126045168
9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 126045168) has the molecular formula C34H33Br2NO3 and a molecular weight of 663.45 g/mol. Its IUPAC name is 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126045168 |
| Molecular Formula | C34H33Br2NO3 |
| Molecular Weight | 663.45 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | 9-[3,5-dibromo-2-(naphthalen-1-ylmethoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C34H33Br2NO3/c1-33(2)14-25-30(27(38)16-33)29(31-26(37-25)15-34(3,4)17-28(31)39)23-12-21(35)13-24(36)32(23)40-18-20-10-7-9-19-8-5-6-11-22(19)20/h5-13,29,37H,14-18H2,1-4H3 |
| InChIKey | AXEBOTIDGATAMN-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.45 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |