C26H20Br2Cl2O4 — CID 126055618
9-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126055618) has the molecular formula C26H20Br2Cl2O4 and a molecular weight of 627.16 g/mol. Its IUPAC name is 9-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126055618 |
| Molecular Formula | C26H20Br2Cl2O4 |
| Molecular Weight | 627.16 g/mol |
| Exact Mass | 623.91 |
| IUPAC Name | 9-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1Cl)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C26H20Br2Cl2O4/c27-14-9-16(26(17(28)10-14)33-12-13-7-8-15(29)11-18(13)30)23-24-19(31)3-1-5-21(24)34-22-6-2-4-20(32)25(22)23/h7-11,23H,1-6,12H2 |
| InChIKey | VOQROKRHYYCRAE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.16 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |