C26H23ClO4 — CID 126077377
9-[3-[(2-chlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126077377) has the molecular formula C26H23ClO4 and a molecular weight of 434.92 g/mol. Its IUPAC name is 9-[3-[(2-chlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3-[(2-chlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126077377 |
| Molecular Formula | C26H23ClO4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 9-[3-[(2-chlorophenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(OCc3ccccc3Cl)c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C26H23ClO4/c27-19-9-2-1-6-17(19)15-30-18-8-3-7-16(14-18)24-25-20(28)10-4-12-22(25)31-23-13-5-11-21(29)26(23)24/h1-3,6-9,14,24H,4-5,10-13,15H2 |
| InChIKey | PRPLJGWDSDYEFI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |