C25H22O6S — CID 126073276
[3-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate (PubChem CID 126073276) has the molecular formula C25H22O6S and a molecular weight of 450.51 g/mol. Its IUPAC name is [3-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate.
| Compound Name | [3-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126073276 |
| Molecular Formula | C25H22O6S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [3-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate |
| SMILES | O=C1CCCC2=C1C(c1cccc(OS(=O)(=O)c3ccccc3)c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C25H22O6S/c26-19-11-5-13-21-24(19)23(25-20(27)12-6-14-22(25)30-21)16-7-4-8-17(15-16)31-32(28,29)18-9-2-1-3-10-18/h1-4,7-10,15,23H,5-6,11-14H2 |
| InChIKey | DBPGWYODNHTMER-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|