C26H25NO6S — CID 126078375
[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenyl] benzenesulfonate (PubChem CID 126078375) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126078375 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(C2C3=C(CCCC3=O)NC3=C2C(=O)CCC3)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO6S/c1-32-23-15-16(13-14-22(23)33-34(30,31)17-7-3-2-4-8-17)24-25-18(9-5-11-20(25)28)27-19-10-6-12-21(29)26(19)24/h2-4,7-8,13-15,24,27H,5-6,9-12H2,1H3 |
| InChIKey | ADUDNJAHCAJNQS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|