C33H39NO6S — CID 126072484
[2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] benzenesulfonate (PubChem CID 126072484) has the molecular formula C33H39NO6S and a molecular weight of 577.74 g/mol. Its IUPAC name is [2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126072484 |
| Molecular Formula | C33H39NO6S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OS(=O)(=O)c3ccccc3)c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C33H39NO6S/c1-7-15-34-23-17-32(2,3)19-25(35)30(23)29(31-24(34)18-33(4,5)20-26(31)36)21-13-14-27(28(16-21)39-6)40-41(37,38)22-11-9-8-10-12-22/h8-14,16,29H,7,15,17-20H2,1-6H3 |
| InChIKey | JYGCCCAOAADPMX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|