C21H18Br2O6 — CID 126072486
2-[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]acetic acid (PubChem CID 126072486) has the molecular formula C21H18Br2O6 and a molecular weight of 526.18 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126072486 |
| Molecular Formula | C21H18Br2O6 |
| Molecular Weight | 526.18 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | 2-[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc1Br |
| InChI | InChI=1S/C21H18Br2O6/c22-11-7-10(8-12(23)21(11)28-9-17(26)27)18-19-13(24)3-1-5-15(19)29-16-6-2-4-14(25)20(16)18/h7-8,18H,1-6,9H2,(H,26,27) |
| InChIKey | AMGJUZFTPQCGBU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.18 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |