C28H25Cl2NO5 — CID 126228804
2-[2,6-dichloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126228804) has the molecular formula C28H25Cl2NO5 and a molecular weight of 526.42 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126228804 |
| Molecular Formula | C28H25Cl2NO5 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 2-[2,6-dichloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(C3C4=C(CCCC4=O)OC4=C3C(=O)CCC4)cc2Cl)cc1 |
| InChI | InChI=1S/C28H25Cl2NO5/c1-15-8-10-17(11-9-15)31-24(34)14-35-28-18(29)12-16(13-19(28)30)25-26-20(32)4-2-6-22(26)36-23-7-3-5-21(33)27(23)25/h8-13,25H,2-7,14H2,1H3,(H,31,34) |
| InChIKey | COKCXHWYEAGJDY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |