C29H27FINO6 — CID 126366186
2-[4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126366186) has the molecular formula C29H27FINO6 and a molecular weight of 631.44 g/mol. Its IUPAC name is 2-[4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126366186 |
| Molecular Formula | C29H27FINO6 |
| Molecular Weight | 631.44 g/mol |
| Exact Mass | 631.09 |
| IUPAC Name | 2-[4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H27FINO6/c1-2-36-24-14-16(13-19(31)29(24)37-15-25(35)32-18-11-9-17(30)10-12-18)26-27-20(33)5-3-7-22(27)38-23-8-4-6-21(34)28(23)26/h9-14,26H,2-8,15H2,1H3,(H,32,35) |
| InChIKey | BIJHFTYPRXDTPX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|