C31H33IN2O5 — CID 126278473
2-[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-iodophenoxy]-N-phenylacetamide (PubChem CID 126278473) has the molecular formula C31H33IN2O5 and a molecular weight of 640.52 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-iodophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-iodophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126278473 |
| Molecular Formula | C31H33IN2O5 |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | 2-[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-iodophenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C31H33IN2O5/c1-3-34-22-12-8-14-24(35)29(22)28(30-23(34)13-9-15-25(30)36)19-16-21(32)31(26(17-19)38-4-2)39-18-27(37)33-20-10-6-5-7-11-20/h5-7,10-11,16-17,28H,3-4,8-9,12-15,18H2,1-2H3,(H,33,37) |
| InChIKey | PNEYXPYCZQQJKZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|