C32H35IN2O5 — CID 126269992
N-(3,4-dimethylphenyl)-2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-iodo-6-methoxyphenoxy]acetamide (PubChem CID 126269992) has the molecular formula C32H35IN2O5 and a molecular weight of 654.55 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-iodo-6-methoxyphenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-iodo-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126269992 |
| Molecular Formula | C32H35IN2O5 |
| Molecular Weight | 654.55 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-iodo-6-methoxyphenoxy]acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(I)c(OCC(=O)Nc3ccc(C)c(C)c3)c(OC)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C32H35IN2O5/c1-5-35-23-8-6-10-25(36)30(23)29(31-24(35)9-7-11-26(31)37)20-15-22(33)32(27(16-20)39-4)40-17-28(38)34-21-13-12-18(2)19(3)14-21/h12-16,29H,5-11,17H2,1-4H3,(H,34,38) |
| InChIKey | OLSVXNCGXZOWOF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|