C32H36BrClN2O5 — CID 46741701
2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-methylacetamide;1-chloro-2-methylbenzene (PubChem CID 46741701) has the molecular formula C32H36BrClN2O5 and a molecular weight of 644.01 g/mol. Its IUPAC name is 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-methylacetamide;1-chloro-2-methylbenzene.
| Compound Name | 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-methylacetamide;1-chloro-2-methylbenzene |
|---|---|
| PubChem CID | 46741701 |
| Molecular Formula | C32H36BrClN2O5 |
| Molecular Weight | 644.01 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-methylacetamide;1-chloro-2-methylbenzene |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Br)c(OCC(=O)NC)c(OC)c2)C2=C1CCCC2=O.Cc1ccccc1Cl |
| InChI | InChI=1S/C25H29BrN2O5.C7H7Cl/c1-4-28-16-7-5-9-18(29)23(16)22(24-17(28)8-6-10-19(24)30)14-11-15(26)25(20(12-14)32-3)33-13-21(31)27-2;1-6-4-2-3-5-7(6)8/h11-12,22H,4-10,13H2,1-3H3,(H,27,31);2-5H,1H3 |
| InChIKey | KTLIOHOMLDAUBC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.01 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |