C31H32Br2N2O4 — CID 126273193
2-[2,6-dibromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126273193) has the molecular formula C31H32Br2N2O4 and a molecular weight of 656.42 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126273193 |
| Molecular Formula | C31H32Br2N2O4 |
| Molecular Weight | 656.42 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | 2-[2,6-dibromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Br)c(OCC(=O)Nc3cccc(C)c3C)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C31H32Br2N2O4/c1-4-35-23-10-6-12-25(36)29(23)28(30-24(35)11-7-13-26(30)37)19-14-20(32)31(21(33)15-19)39-16-27(38)34-22-9-5-8-17(2)18(22)3/h5,8-9,14-15,28H,4,6-7,10-13,16H2,1-3H3,(H,34,38) |
| InChIKey | RJWNMXRCELGWGX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.42 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |