C33H36BrFN2O5 — CID 126368439
2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126368439) has the molecular formula C33H36BrFN2O5 and a molecular weight of 639.56 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126368439 |
| Molecular Formula | C33H36BrFN2O5 |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C33H36BrFN2O5/c1-6-41-26-12-18(11-21(34)31(26)42-17-27(40)36-20-9-7-19(35)8-10-20)28-29-22(13-32(2,3)15-24(29)38)37-23-14-33(4,5)16-25(39)30(23)28/h7-12,28,37H,6,13-17H2,1-5H3,(H,36,40) |
| InChIKey | LLBKLBNLTALWOB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |