C32H33Br2ClN2O4 — CID 126266685
N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide (PubChem CID 126266685) has the molecular formula C32H33Br2ClN2O4 and a molecular weight of 704.89 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126266685 |
| Molecular Formula | C32H33Br2ClN2O4 |
| Molecular Weight | 704.89 g/mol |
| Exact Mass | 702.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)cc2Br)cc1Cl |
| InChI | InChI=1S/C32H33Br2ClN2O4/c1-16-6-7-18(10-21(16)35)36-26(40)15-41-30-19(33)8-17(9-20(30)34)27-28-22(11-31(2,3)13-24(28)38)37-23-12-32(4,5)14-25(39)29(23)27/h6-10,27,37H,11-15H2,1-5H3,(H,36,40) |
| InChIKey | RKASVURRYCGJMH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.89 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |