C32H34Br2N2O4 — CID 126233672
2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126233672) has the molecular formula C32H34Br2N2O4 and a molecular weight of 670.44 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126233672 |
| Molecular Formula | C32H34Br2N2O4 |
| Molecular Weight | 670.44 g/mol |
| Exact Mass | 668.09 |
| IUPAC Name | 2-[2,6-dibromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)cc2Br)cc1 |
| InChI | InChI=1S/C32H34Br2N2O4/c1-17-6-8-19(9-7-17)35-26(39)16-40-30-20(33)10-18(11-21(30)34)27-28-22(12-31(2,3)14-24(28)37)36-23-13-32(4,5)15-25(38)29(23)27/h6-11,27,36H,12-16H2,1-5H3,(H,35,39) |
| InChIKey | ZBTFWVWOVPHLLB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.44 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |