C33H36BrNO6 — CID 126259181
2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide (PubChem CID 126259181) has the molecular formula C33H36BrNO6 and a molecular weight of 622.56 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126259181 |
| Molecular Formula | C33H36BrNO6 |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H36BrNO6/c1-6-39-24-13-19(12-21(34)31(24)40-18-27(38)35-20-10-8-7-9-11-20)28-29-22(36)14-32(2,3)16-25(29)41-26-17-33(4,5)15-23(37)30(26)28/h7-13,28H,6,14-18H2,1-5H3,(H,35,38) |
| InChIKey | AJKUTAXNAPKUJL-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |