C30H30ClNO7 — CID 126393266
2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-6-ethoxyphenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126393266) has the molecular formula C30H30ClNO7 and a molecular weight of 552.02 g/mol. Its IUPAC name is 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-6-ethoxyphenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-6-ethoxyphenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126393266 |
| Molecular Formula | C30H30ClNO7 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-6-ethoxyphenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(Cl)c1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C30H30ClNO7/c1-3-37-25-15-17(14-18(31)30(25)38-16-26(35)32-19-8-4-5-11-22(19)36-2)27-28-20(33)9-6-12-23(28)39-24-13-7-10-21(34)29(24)27/h4-5,8,11,14-15,27H,3,6-7,9-10,12-13,16H2,1-2H3,(H,32,35) |
| InChIKey | VTFHKLLQECMEJK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |