C30H32N2O5 — CID 126390435
2-[2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126390435) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126390435 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccccc2OCC(=O)Nc2ccccc2OC)C2=C1CCCC2=O |
| InChI | InChI=1S/C30H32N2O5/c1-3-32-21-12-8-14-23(33)29(21)28(30-22(32)13-9-15-24(30)34)19-10-4-6-16-25(19)37-18-27(35)31-20-11-5-7-17-26(20)36-2/h4-7,10-11,16-17,28H,3,8-9,12-15,18H2,1-2H3,(H,31,35) |
| InChIKey | KTACHZGZWJKROA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |