C28H26ClNO6 — CID 126382700
2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126382700) has the molecular formula C28H26ClNO6 and a molecular weight of 507.97 g/mol. Its IUPAC name is 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126382700 |
| Molecular Formula | C28H26ClNO6 |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 2-[2-chloro-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc1Cl |
| InChI | InChI=1S/C28H26ClNO6/c1-34-22-9-3-2-6-18(22)30-25(33)15-35-21-13-12-16(14-17(21)29)26-27-19(31)7-4-10-23(27)36-24-11-5-8-20(32)28(24)26/h2-3,6,9,12-14,26H,4-5,7-8,10-11,15H2,1H3,(H,30,33) |
| InChIKey | MEHRGZZAHHKFBQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |