C28H28BrNO6S — CID 126078816
[2-bromo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126078816) has the molecular formula C28H28BrNO6S and a molecular weight of 586.50 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126078816 |
| Molecular Formula | C28H28BrNO6S |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | [2-bromo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(C)C3=C2C(=O)CCC3)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28BrNO6S/c1-16-10-12-18(13-11-16)37(33,34)36-28-19(29)14-17(15-24(28)35-3)25-26-20(6-4-8-22(26)31)30(2)21-7-5-9-23(32)27(21)25/h10-15,25H,4-9H2,1-3H3 |
| InChIKey | NOHHFUTYQNSAJZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|