C30H31ClINO6S — CID 126082496
[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126082496) has the molecular formula C30H31ClINO6S and a molecular weight of 696.00 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126082496 |
| Molecular Formula | C30H31ClINO6S |
| Molecular Weight | 696.00 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | [2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(I)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H31ClINO6S/c1-29(2)12-20-26(22(34)14-29)25(27-21(33-20)13-30(3,4)15-23(27)35)16-10-19(32)28(24(11-16)38-5)39-40(36,37)18-8-6-17(31)7-9-18/h6-11,25,33H,12-15H2,1-5H3 |
| InChIKey | YFNFSLRLUJBCGA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.00 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|