C28H36ClNO4 — CID 2900717
9-(3-chloro-5-ethoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 2900717) has the molecular formula C28H36ClNO4 and a molecular weight of 486.05 g/mol. Its IUPAC name is 9-(3-chloro-5-ethoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3-chloro-5-ethoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 2900717 |
| Molecular Formula | C28H36ClNO4 |
| Molecular Weight | 486.05 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 9-(3-chloro-5-ethoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CCCOc1c(Cl)cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc1OCC |
| InChI | InChI=1S/C28H36ClNO4/c1-7-9-34-26-17(29)10-16(11-22(26)33-8-2)23-24-18(12-27(3,4)14-20(24)31)30-19-13-28(5,6)15-21(32)25(19)23/h10-11,23,30H,7-9,12-15H2,1-6H3 |
| InChIKey | VRSSUHAGXZHMFG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.05 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |