C27H35NO3 — CID 3843763
9-(4-butoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 3843763) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is 9-(4-butoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(4-butoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 3843763 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 9-(4-butoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CCCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C27H35NO3/c1-6-7-12-31-18-10-8-17(9-11-18)23-24-19(13-26(2,3)15-21(24)29)28-20-14-27(4,5)16-22(30)25(20)23/h8-11,23,28H,6-7,12-16H2,1-5H3 |
| InChIKey | ROATYJXMZIDVPZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|