C26H29NO4 — CID 17060617
8,8-dimethyl-11-(4-propoxyphenyl)-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one (PubChem CID 17060617) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 8,8-dimethyl-11-(4-propoxyphenyl)-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one.
| Compound Name | 8,8-dimethyl-11-(4-propoxyphenyl)-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one |
|---|---|
| PubChem CID | 17060617 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 8,8-dimethyl-11-(4-propoxyphenyl)-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one |
| SMILES | CCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3cc4c(cc32)OCCO4)cc1 |
| InChI | InChI=1S/C26H29NO4/c1-4-9-29-17-7-5-16(6-8-17)24-18-12-22-23(31-11-10-30-22)13-19(18)27-20-14-26(2,3)15-21(28)25(20)24/h5-8,12-13,24,27H,4,9-11,14-15H2,1-3H3 |
| InChIKey | OIHNVHAGGTTWPX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |