C23H23NO3 — CID 7363321
(11S)-8,8-dimethyl-11-phenyl-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one (PubChem CID 7363321) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (11S)-8,8-dimethyl-11-phenyl-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one.
| Compound Name | (11S)-8,8-dimethyl-11-phenyl-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one |
|---|---|
| PubChem CID | 7363321 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (11S)-8,8-dimethyl-11-phenyl-2,3,6,7,9,11-hexahydro-[1,4]benzodioxino[6,7-b]quinolin-10-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1cc3c(cc1[C@@H]2c1ccccc1)OCCO3 |
| InChI | InChI=1S/C23H23NO3/c1-23(2)12-17-22(18(25)13-23)21(14-6-4-3-5-7-14)15-10-19-20(11-16(15)24-17)27-9-8-26-19/h3-7,10-11,21,24H,8-9,12-13H2,1-2H3/t21-/m0/s1 |
| InChIKey | LDOLPGNWJAWNLV-NRFANRHFSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |