C20H19NO3S — CID 27879470
(10S)-7,7-dimethyl-10-thiophen-2-yl-5,6,8,10-tetrahydro-[1,3]benzodioxolo[5,6-b]quinolin-9-one (PubChem CID 27879470) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is (10S)-7,7-dimethyl-10-thiophen-2-yl-5,6,8,10-tetrahydro-[1,3]benzodioxolo[5,6-b]quinolin-9-one.
| Compound Name | (10S)-7,7-dimethyl-10-thiophen-2-yl-5,6,8,10-tetrahydro-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
|---|---|
| PubChem CID | 27879470 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (10S)-7,7-dimethyl-10-thiophen-2-yl-5,6,8,10-tetrahydro-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1cc3c(cc1[C@@H]2c1cccs1)OCO3 |
| InChI | InChI=1S/C20H19NO3S/c1-20(2)8-13-19(14(22)9-20)18(17-4-3-5-25-17)11-6-15-16(24-10-23-15)7-12(11)21-13/h3-7,18,21H,8-10H2,1-2H3/t18-/m1/s1 |
| InChIKey | GRKAFZBSKLNUJO-GOSISDBHSA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |