C32H34Br2FNO3 — CID 126050717
9-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126050717) has the molecular formula C32H34Br2FNO3 and a molecular weight of 659.43 g/mol. Its IUPAC name is 9-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126050717 |
| Molecular Formula | C32H34Br2FNO3 |
| Molecular Weight | 659.43 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | 9-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)c(OCc3ccc(F)cc3)c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H34Br2FNO3/c1-6-36-23-13-31(2,3)15-25(37)28(23)27(29-24(36)14-32(4,5)16-26(29)38)19-11-21(33)30(22(34)12-19)39-17-18-7-9-20(35)10-8-18/h7-12,27H,6,13-17H2,1-5H3 |
| InChIKey | BPXIAYCPVVGZEG-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.43 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |