C37H37NO6 — CID 126078610
2-[9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126078610) has the molecular formula C37H37NO6 and a molecular weight of 591.70 g/mol. Its IUPAC name is 2-[9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126078610 |
| Molecular Formula | C37H37NO6 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-[9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C37H37NO6/c1-3-10-24-19-26(20-32(43-4-2)37(24)44-22-25-13-7-12-23-11-5-6-14-27(23)25)34-35-28(15-8-17-30(35)39)38(21-33(41)42)29-16-9-18-31(40)36(29)34/h3,5-7,11-14,19-20,34H,1,4,8-10,15-18,21-22H2,2H3,(H,41,42) |
| InChIKey | MTAITUIEJDQDEA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|