C23H24INO6 — CID 4764444
2-[9-(3-iodo-4,5-dimethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 4764444) has the molecular formula C23H24INO6 and a molecular weight of 537.35 g/mol. Its IUPAC name is 2-[9-(3-iodo-4,5-dimethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3-iodo-4,5-dimethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 4764444 |
| Molecular Formula | C23H24INO6 |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 2-[9-(3-iodo-4,5-dimethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(I)c1OC |
| InChI | InChI=1S/C23H24INO6/c1-30-18-10-12(9-13(24)23(18)31-2)20-21-14(5-3-7-16(21)26)25(11-19(28)29)15-6-4-8-17(27)22(15)20/h9-10,20H,3-8,11H2,1-2H3,(H,28,29) |
| InChIKey | LFIINMQQJZMGJH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|