C23H18N2O3 — CID 167512794
11-methylidene-10-(4-nitrophenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-9-one (PubChem CID 167512794) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 11-methylidene-10-(4-nitrophenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-9-one.
| Compound Name | 11-methylidene-10-(4-nitrophenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-9-one |
|---|---|
| PubChem CID | 167512794 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 11-methylidene-10-(4-nitrophenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-9-one |
| SMILES | C=C1C2=C(NC3=C(C(=O)CCC3)C2c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C23H18N2O3/c1-13-16-5-2-3-6-17(16)23-20(13)21(14-9-11-15(12-10-14)25(27)28)22-18(24-23)7-4-8-19(22)26/h2-3,5-6,9-12,21,24H,1,4,7-8H2 |
| InChIKey | KBRGEJLDHCUOCM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|