C23H18N2O3 — CID 42642087
7-(4-nitrophenyl)-9,10,11,12-tetrahydro-7H-naphtho[1,2-b]quinolin-8-one (PubChem CID 42642087) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-9,10,11,12-tetrahydro-7H-naphtho[1,2-b]quinolin-8-one.
| Compound Name | 7-(4-nitrophenyl)-9,10,11,12-tetrahydro-7H-naphtho[1,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 42642087 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 7-(4-nitrophenyl)-9,10,11,12-tetrahydro-7H-naphtho[1,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1ccc([N+](=O)[O-])cc1)c1ccc3ccccc3c1N2 |
| InChI | InChI=1S/C23H18N2O3/c26-20-7-3-6-19-22(20)21(15-8-11-16(12-9-15)25(27)28)18-13-10-14-4-1-2-5-17(14)23(18)24-19/h1-2,4-5,8-13,21,24H,3,6-7H2 |
| InChIKey | LXQLSWIMGUUKNR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|