C25H24N2O — CID 14171492
7-(4-aminophenyl)-10,10-dimethyl-7,9,11,12-tetrahydronaphtho[1,2-b]quinolin-8-one (PubChem CID 14171492) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is 7-(4-aminophenyl)-10,10-dimethyl-7,9,11,12-tetrahydronaphtho[1,2-b]quinolin-8-one.
| Compound Name | 7-(4-aminophenyl)-10,10-dimethyl-7,9,11,12-tetrahydronaphtho[1,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 14171492 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 7-(4-aminophenyl)-10,10-dimethyl-7,9,11,12-tetrahydronaphtho[1,2-b]quinolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1c(ccc3ccccc13)C2c1ccc(N)cc1 |
| InChI | InChI=1S/C25H24N2O/c1-25(2)13-20-23(21(28)14-25)22(16-7-10-17(26)11-8-16)19-12-9-15-5-3-4-6-18(15)24(19)27-20/h3-12,22,27H,13-14,26H2,1-2H3 |
| InChIKey | KQTSUVXCPKEKTD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|