C21H19NO6 — CID 132574975
6,8-dimethoxy-9-(3-nitrophenyl)-2,3,4,9-tetrahydroxanthen-1-one (PubChem CID 132574975) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 6,8-dimethoxy-9-(3-nitrophenyl)-2,3,4,9-tetrahydroxanthen-1-one.
| Compound Name | 6,8-dimethoxy-9-(3-nitrophenyl)-2,3,4,9-tetrahydroxanthen-1-one |
|---|---|
| PubChem CID | 132574975 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 6,8-dimethoxy-9-(3-nitrophenyl)-2,3,4,9-tetrahydroxanthen-1-one |
| SMILES | COc1cc(OC)c2c(c1)OC1=C(C(=O)CCC1)C2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19NO6/c1-26-14-10-17(27-2)21-18(11-14)28-16-8-4-7-15(23)20(16)19(21)12-5-3-6-13(9-12)22(24)25/h3,5-6,9-11,19H,4,7-8H2,1-2H3 |
| InChIKey | AHPINCIFMHCFHK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|