C22H21N3O4 — CID 102421049
11-amino-12-(3-nitrophenyl)-2,3,4,7,8,9,10,12-octahydrochromeno[2,3-b]quinolin-1-one (PubChem CID 102421049) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 11-amino-12-(3-nitrophenyl)-2,3,4,7,8,9,10,12-octahydrochromeno[2,3-b]quinolin-1-one.
| Compound Name | 11-amino-12-(3-nitrophenyl)-2,3,4,7,8,9,10,12-octahydrochromeno[2,3-b]quinolin-1-one |
|---|---|
| PubChem CID | 102421049 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 11-amino-12-(3-nitrophenyl)-2,3,4,7,8,9,10,12-octahydrochromeno[2,3-b]quinolin-1-one |
| SMILES | Nc1c2c(nc3c1C(c1cccc([N+](=O)[O-])c1)C1=C(CCCC1=O)O3)CCCC2 |
| InChI | InChI=1S/C22H21N3O4/c23-21-14-7-1-2-8-15(14)24-22-20(21)18(12-5-3-6-13(11-12)25(27)28)19-16(26)9-4-10-17(19)29-22/h3,5-6,11,18H,1-2,4,7-10H2,(H2,23,24) |
| InChIKey | KVESKDWTQLQPRA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|