C36H31N2O6P — CID 139226206
ethyl 4-(3-nitrophenyl)-5-oxo-2-[(triphenyl-λ5-phosphanylidene)amino]-4,6,7,8-tetrahydrochromene-3-carboxylate (PubChem CID 139226206) has the molecular formula C36H31N2O6P and a molecular weight of 618.63 g/mol. Its IUPAC name is ethyl 4-(3-nitrophenyl)-5-oxo-2-[(triphenyl-λ5-phosphanylidene)amino]-4,6,7,8-tetrahydrochromene-3-carboxylate.
| Compound Name | ethyl 4-(3-nitrophenyl)-5-oxo-2-[(triphenyl-λ5-phosphanylidene)amino]-4,6,7,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 139226206 |
| Molecular Formula | C36H31N2O6P |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | ethyl 4-(3-nitrophenyl)-5-oxo-2-[(triphenyl-λ5-phosphanylidene)amino]-4,6,7,8-tetrahydrochromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)OC2=C(C(=O)CCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H31N2O6P/c1-2-43-36(40)34-32(25-14-12-15-26(24-25)38(41)42)33-30(39)22-13-23-31(33)44-35(34)37-45(27-16-6-3-7-17-27,28-18-8-4-9-19-28)29-20-10-5-11-21-29/h3-12,14-21,24,32H,2,13,22-23H2,1H3 |
| InChIKey | KDYHWJSUSPVXBK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|