C34H28N4O10 — CID 139068029
diethyl (1R,7S)-3,9-diamino-1,7-bis(3-nitrophenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarboxylate (PubChem CID 139068029) has the molecular formula C34H28N4O10 and a molecular weight of 652.62 g/mol. Its IUPAC name is diethyl (1R,7S)-3,9-diamino-1,7-bis(3-nitrophenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarboxylate.
| Compound Name | diethyl (1R,7S)-3,9-diamino-1,7-bis(3-nitrophenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 139068029 |
| Molecular Formula | C34H28N4O10 |
| Molecular Weight | 652.62 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | diethyl (1R,7S)-3,9-diamino-1,7-bis(3-nitrophenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2c(ccc3c4c(ccc23)[C@H](c2cccc([N+](=O)[O-])c2)C(C(=O)OCC)=C(N)O4)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H28N4O10/c1-3-45-33(39)27-25(17-7-5-9-19(15-17)37(41)42)23-13-11-22-21(29(23)47-31(27)35)12-14-24-26(18-8-6-10-20(16-18)38(43)44)28(34(40)46-4-2)32(36)48-30(22)24/h5-16,25-26H,3-4,35-36H2,1-2H3/t25-,26+ |
| InChIKey | CQVGSNLWVFGPEJ-WMPKNSHKSA-N |
| XLogP | 5.17 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|