C23H22N2O7 — CID 141275279
diethyl (2R)-3-benzoyl-2-(3-nitrophenyl)-1,2-dihydropyrrole-5,5-dicarboxylate (PubChem CID 141275279) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is diethyl (2R)-3-benzoyl-2-(3-nitrophenyl)-1,2-dihydropyrrole-5,5-dicarboxylate.
| Compound Name | diethyl (2R)-3-benzoyl-2-(3-nitrophenyl)-1,2-dihydropyrrole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 141275279 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | diethyl (2R)-3-benzoyl-2-(3-nitrophenyl)-1,2-dihydropyrrole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C=C(C(=O)c2ccccc2)[C@@H](c2cccc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C23H22N2O7/c1-3-31-21(27)23(22(28)32-4-2)14-18(20(26)15-9-6-5-7-10-15)19(24-23)16-11-8-12-17(13-16)25(29)30/h5-14,19,24H,3-4H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZCZQEWXTKKMYKX-LJQANCHMSA-N |
| XLogP | 2.91 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|