C27H28N2O6 — CID 22841802
diethyl 2-methyl-4-(3-nitrophenyl)-6-[(1R,2S)-2-phenylcyclopropyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 22841802) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is diethyl 2-methyl-4-(3-nitrophenyl)-6-[(1R,2S)-2-phenylcyclopropyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-methyl-4-(3-nitrophenyl)-6-[(1R,2S)-2-phenylcyclopropyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22841802 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | diethyl 2-methyl-4-(3-nitrophenyl)-6-[(1R,2S)-2-phenylcyclopropyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC([C@@H]2C[C@@H]2c2ccccc2)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H28N2O6/c1-4-34-26(30)22-16(3)28-25(21-15-20(21)17-10-7-6-8-11-17)24(27(31)35-5-2)23(22)18-12-9-13-19(14-18)29(32)33/h6-14,20-21,23,28H,4-5,15H2,1-3H3/t20-,21-,23?/m1/s1 |
| InChIKey | VKNVAYTWHGNRGY-OJOWTSHBSA-N |
| XLogP | 4.74 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|