C23H28N2O8 — CID 88717374
5-O-[dihydroxy-(1-methylcyclobutyl)methyl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88717374) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is 5-O-[dihydroxy-(1-methylcyclobutyl)methyl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[dihydroxy-(1-methylcyclobutyl)methyl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88717374 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 5-O-[dihydroxy-(1-methylcyclobutyl)methyl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(O)(O)C2(C)CCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N2O8/c1-5-32-20(26)17-13(2)24-14(3)18(19(17)15-8-6-9-16(12-15)25(30)31)21(27)33-23(28,29)22(4)10-7-11-22/h6,8-9,12,19,24,28-29H,5,7,10-11H2,1-4H3 |
| InChIKey | IYPNPEVYMDDTIW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|