C25H21ClN2O4 — CID 139226195
ethyl 2-[(4-chlorophenyl)iminomethylideneamino]-5-oxo-4-phenyl-4,6,7,8-tetrahydrochromene-3-carboxylate (PubChem CID 139226195) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)iminomethylideneamino]-5-oxo-4-phenyl-4,6,7,8-tetrahydrochromene-3-carboxylate.
| Compound Name | ethyl 2-[(4-chlorophenyl)iminomethylideneamino]-5-oxo-4-phenyl-4,6,7,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 139226195 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)iminomethylideneamino]-5-oxo-4-phenyl-4,6,7,8-tetrahydrochromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N=C=Nc2ccc(Cl)cc2)OC2=C(C(=O)CCC2)C1c1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O4/c1-2-31-25(30)23-21(16-7-4-3-5-8-16)22-19(29)9-6-10-20(22)32-24(23)28-15-27-18-13-11-17(26)12-14-18/h3-5,7-8,11-14,21H,2,6,9-10H2,1H3 |
| InChIKey | GPIKJLZHQTUACW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|