C24H21N3O4 — CID 27878902
(4R)-1-benzyl-3-methyl-4-(3-nitrophenyl)-4,6,7,8-tetrahydrochromeno[3,2-d]pyrazol-5-one (PubChem CID 27878902) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (4R)-1-benzyl-3-methyl-4-(3-nitrophenyl)-4,6,7,8-tetrahydrochromeno[3,2-d]pyrazol-5-one.
| Compound Name | (4R)-1-benzyl-3-methyl-4-(3-nitrophenyl)-4,6,7,8-tetrahydrochromeno[3,2-d]pyrazol-5-one |
|---|---|
| PubChem CID | 27878902 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (4R)-1-benzyl-3-methyl-4-(3-nitrophenyl)-4,6,7,8-tetrahydrochromeno[3,2-d]pyrazol-5-one |
| SMILES | Cc1nn(Cc2ccccc2)c2c1[C@@H](c1cccc([N+](=O)[O-])c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C24H21N3O4/c1-15-21-22(17-9-5-10-18(13-17)27(29)30)23-19(28)11-6-12-20(23)31-24(21)26(25-15)14-16-7-3-2-4-8-16/h2-5,7-10,13,22H,6,11-12,14H2,1H3/t22-/m1/s1 |
| InChIKey | GSCSHJDQQYQQTD-JOCHJYFZSA-N |
| XLogP | 4.68 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|