C23H17Br2N3O5 — CID 126139352
(4R)-2-amino-4-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 126139352) has the molecular formula C23H17Br2N3O5 and a molecular weight of 575.21 g/mol. Its IUPAC name is (4R)-2-amino-4-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 126139352 |
| Molecular Formula | C23H17Br2N3O5 |
| Molecular Weight | 575.21 g/mol |
| Exact Mass | 572.95 |
| IUPAC Name | (4R)-2-amino-4-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)CCC2)[C@@H]1c1cc(Br)c(OCc2cccc([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C23H17Br2N3O5/c24-16-8-13(20-15(10-26)23(27)33-19-6-2-5-18(29)21(19)20)9-17(25)22(16)32-11-12-3-1-4-14(7-12)28(30)31/h1,3-4,7-9,20H,2,5-6,11,27H2/t20-/m1/s1 |
| InChIKey | QJSVHAGSXZPUTR-HXUWFJFHSA-N |
| XLogP | 5.51 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|