C23H18BrN3O5 — CID 126132506
(4R)-2-amino-4-[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 126132506) has the molecular formula C23H18BrN3O5 and a molecular weight of 496.32 g/mol. Its IUPAC name is (4R)-2-amino-4-[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 126132506 |
| Molecular Formula | C23H18BrN3O5 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | (4R)-2-amino-4-[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)CCC2)[C@@H]1c1cc(Br)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18BrN3O5/c24-14-6-9-19(31-12-13-4-7-15(8-5-13)27(29)30)16(10-14)21-17(11-25)23(26)32-20-3-1-2-18(28)22(20)21/h4-10,21H,1-3,12,26H2/t21-/m1/s1 |
| InChIKey | AXWCFIUXENQWNA-OAQYLSRUSA-N |
| XLogP | 4.75 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|