C22H15NO6 — CID 57380802
7-(4-nitrophenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione (PubChem CID 57380802) has the molecular formula C22H15NO6 and a molecular weight of 389.36 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione.
| Compound Name | 7-(4-nitrophenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione |
|---|---|
| PubChem CID | 57380802 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 7-(4-nitrophenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc([N+](=O)[O-])cc1)c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C22H15NO6/c24-15-5-3-7-17-19(15)18(12-8-10-13(11-9-12)23(26)27)20-21(28-17)14-4-1-2-6-16(14)29-22(20)25/h1-2,4,6,8-11,18H,3,5,7H2 |
| InChIKey | JLRYTXOEHBALQB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|